C14H22 — CID 14765824
tetracyclo[6.6.0.01,11.03,7]tetradecane (PubChem CID 14765824) has the molecular formula C14H22 and a molecular weight of 190.33 g/mol. Its IUPAC name is tetracyclo[6.6.0.01,11.03,7]tetradecane.
| Compound Name | tetracyclo[6.6.0.01,11.03,7]tetradecane |
|---|---|
| PubChem CID | 14765824 |
| Molecular Formula | C14H22 |
| Molecular Weight | 190.33 g/mol |
| Exact Mass | 190.17 |
| IUPAC Name | tetracyclo[6.6.0.01,11.03,7]tetradecane |
| SMILES | C1CC2CC34CCCC3CCC4C2C1 |
| InChI | InChI=1S/C14H22/c1-3-10-9-14-8-2-4-11(14)6-7-13(14)12(10)5-1/h10-13H,1-9H2 |
| InChIKey | XXBKEVODEIXZPG-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.33 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |