C15H26 — CID 162924951
(1R,2S,5R,8R)-2,6,6,8-tetramethyltricyclo[6.3.0.01,5]undecane (PubChem CID 162924951) has the molecular formula C15H26 and a molecular weight of 206.37 g/mol. Its IUPAC name is (1R,2S,5R,8R)-2,6,6,8-tetramethyltricyclo[6.3.0.01,5]undecane.
| Compound Name | (1R,2S,5R,8R)-2,6,6,8-tetramethyltricyclo[6.3.0.01,5]undecane |
|---|---|
| PubChem CID | 162924951 |
| Molecular Formula | C15H26 |
| Molecular Weight | 206.37 g/mol |
| Exact Mass | 206.20 |
| IUPAC Name | (1R,2S,5R,8R)-2,6,6,8-tetramethyltricyclo[6.3.0.01,5]undecane |
| SMILES | C[C@H]1CC[C@@H]2C(C)(C)C[C@@]3(C)CCC[C@]213 |
| InChI | InChI=1S/C15H26/c1-11-6-7-12-13(2,3)10-14(4)8-5-9-15(11,12)14/h11-12H,5-10H2,1-4H3/t11-,12+,14+,15+/m0/s1 |
| InChIKey | UTBQVGNGGLSSEH-CTHBEMJXSA-N |
| XLogP | 4.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.37 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |