C32H29F3N4O3S — CID 147661614
(2Z)-3-(2-ethylphenyl)-2-[2-oxo-6-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]hexylidene]-1,3-thiazolidin-4-one (PubChem CID 147661614) has the molecular formula C32H29F3N4O3S and a molecular weight of 606.67 g/mol. Its IUPAC name is (2Z)-3-(2-ethylphenyl)-2-[2-oxo-6-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]hexylidene]-1,3-thiazolidin-4-one.
| Compound Name | (2Z)-3-(2-ethylphenyl)-2-[2-oxo-6-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]hexylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 147661614 |
| Molecular Formula | C32H29F3N4O3S |
| Molecular Weight | 606.67 g/mol |
| Exact Mass | 606.19 |
| IUPAC Name | (2Z)-3-(2-ethylphenyl)-2-[2-oxo-6-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]hexylidene]-1,3-thiazolidin-4-one |
| SMILES | CCc1ccccc1N1C(=O)CS/C1=C\C(=O)CCCCc1ccc(-c2ncn(-c3ccc(OC(F)(F)F)cc3)n2)cc1 |
| InChI | InChI=1S/C32H29F3N4O3S/c1-2-23-8-4-6-10-28(23)39-29(41)20-43-30(39)19-26(40)9-5-3-7-22-11-13-24(14-12-22)31-36-21-38(37-31)25-15-17-27(18-16-25)42-32(33,34)35/h4,6,8,10-19,21H,2-3,5,7,9,20H2,1H3/b30-19- |
| InChIKey | GLLXITSLDAHOTA-FSGOGVSDSA-N |
| XLogP | 7.30 |
| TPSA | 77.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.67 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|