C20H26N2O5 — CID 147679276
benzyl 2-[2-(5-methoxy-5-oxopentoxy)ethyl]-5-methylpyrazole-3-carboxylate (PubChem CID 147679276) has the molecular formula C20H26N2O5 and a molecular weight of 374.44 g/mol. Its IUPAC name is benzyl 2-[2-(5-methoxy-5-oxopentoxy)ethyl]-5-methylpyrazole-3-carboxylate.
| Compound Name | benzyl 2-[2-(5-methoxy-5-oxopentoxy)ethyl]-5-methylpyrazole-3-carboxylate |
|---|---|
| PubChem CID | 147679276 |
| Molecular Formula | C20H26N2O5 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.18 |
| IUPAC Name | benzyl 2-[2-(5-methoxy-5-oxopentoxy)ethyl]-5-methylpyrazole-3-carboxylate |
| SMILES | COC(=O)CCCCOCCn1nc(C)cc1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C20H26N2O5/c1-16-14-18(20(24)27-15-17-8-4-3-5-9-17)22(21-16)11-13-26-12-7-6-10-19(23)25-2/h3-5,8-9,14H,6-7,10-13,15H2,1-2H3 |
| InChIKey | GOUBPSMSATXXNH-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 79.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|