C6H12O2S — CID 147684121
5-propan-2-yl-1,3-dioxolane-4-thiol (PubChem CID 147684121) has the molecular formula C6H12O2S and a molecular weight of 148.23 g/mol. Its IUPAC name is 5-propan-2-yl-1,3-dioxolane-4-thiol.
| Compound Name | 5-propan-2-yl-1,3-dioxolane-4-thiol |
|---|---|
| PubChem CID | 147684121 |
| Molecular Formula | C6H12O2S |
| Molecular Weight | 148.23 g/mol |
| Exact Mass | 148.06 |
| IUPAC Name | 5-propan-2-yl-1,3-dioxolane-4-thiol |
| SMILES | CC(C)C1OCOC1S |
| InChI | InChI=1S/C6H12O2S/c1-4(2)5-6(9)8-3-7-5/h4-6,9H,3H2,1-2H3 |
| InChIKey | GPRPGOUHAORXOD-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 18.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.23 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|