C19H25Cl2N5O6 — CID 14769968
2-[[5-[3-(3-aminobutanoylamino)-4-methoxyphenyl]pyridine-3-carbonyl]amino]ethyl nitrate;dihydrochloride (PubChem CID 14769968) has the molecular formula C19H25Cl2N5O6 and a molecular weight of 490.34 g/mol. Its IUPAC name is 2-[[5-[3-(3-aminobutanoylamino)-4-methoxyphenyl]pyridine-3-carbonyl]amino]ethyl nitrate;dihydrochloride.
| Compound Name | 2-[[5-[3-(3-aminobutanoylamino)-4-methoxyphenyl]pyridine-3-carbonyl]amino]ethyl nitrate;dihydrochloride |
|---|---|
| PubChem CID | 14769968 |
| Molecular Formula | C19H25Cl2N5O6 |
| Molecular Weight | 490.34 g/mol |
| Exact Mass | 489.12 |
| IUPAC Name | 2-[[5-[3-(3-aminobutanoylamino)-4-methoxyphenyl]pyridine-3-carbonyl]amino]ethyl nitrate;dihydrochloride |
| SMILES | COc1ccc(-c2cncc(C(=O)NCCO[N+](=O)[O-])c2)cc1NC(=O)CC(C)N.Cl.Cl |
| InChI | InChI=1S/C19H23N5O6.2ClH/c1-12(20)7-18(25)23-16-9-13(3-4-17(16)29-2)14-8-15(11-21-10-14)19(26)22-5-6-30-24(27)28;;/h3-4,8-12H,5-7,20H2,1-2H3,(H,22,26)(H,23,25);2*1H |
| InChIKey | VCZMSWXDHWJODG-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 158.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.34 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|