C23H20N2O3S — CID 14770100
10-(3-hydroxypiperidine-1-carbonyl)-8-phenylthieno[2,3-a]quinolizin-7-one (PubChem CID 14770100) has the molecular formula C23H20N2O3S and a molecular weight of 404.49 g/mol. Its IUPAC name is 10-(3-hydroxypiperidine-1-carbonyl)-8-phenylthieno[2,3-a]quinolizin-7-one.
| Compound Name | 10-(3-hydroxypiperidine-1-carbonyl)-8-phenylthieno[2,3-a]quinolizin-7-one |
|---|---|
| PubChem CID | 14770100 |
| Molecular Formula | C23H20N2O3S |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.12 |
| IUPAC Name | 10-(3-hydroxypiperidine-1-carbonyl)-8-phenylthieno[2,3-a]quinolizin-7-one |
| SMILES | O=C(c1cc(-c2ccccc2)c(=O)n2ccc3ccsc3c12)N1CCCC(O)C1 |
| InChI | InChI=1S/C23H20N2O3S/c26-17-7-4-10-24(14-17)22(27)19-13-18(15-5-2-1-3-6-15)23(28)25-11-8-16-9-12-29-21(16)20(19)25/h1-3,5-6,8-9,11-13,17,26H,4,7,10,14H2 |
| InChIKey | JYKYEJQQUFFYLC-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 62.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |