C22H23N3O2S2 — CID 14770179
N-[2-(dimethylamino)ethyl]-11-oxo-12-phenyl-3,7-dithia-10-azatricyclo[8.4.0.02,6]tetradeca-1(14),2(6),4,12-tetraene-14-carboxamide (PubChem CID 14770179) has the molecular formula C22H23N3O2S2 and a molecular weight of 425.58 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-11-oxo-12-phenyl-3,7-dithia-10-azatricyclo[8.4.0.02,6]tetradeca-1(14),2(6),4,12-tetraene-14-carboxamide.
| Compound Name | N-[2-(dimethylamino)ethyl]-11-oxo-12-phenyl-3,7-dithia-10-azatricyclo[8.4.0.02,6]tetradeca-1(14),2(6),4,12-tetraene-14-carboxamide |
|---|---|
| PubChem CID | 14770179 |
| Molecular Formula | C22H23N3O2S2 |
| Molecular Weight | 425.58 g/mol |
| Exact Mass | 425.12 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-11-oxo-12-phenyl-3,7-dithia-10-azatricyclo[8.4.0.02,6]tetradeca-1(14),2(6),4,12-tetraene-14-carboxamide |
| SMILES | CN(C)CCNC(=O)c1cc(-c2ccccc2)c(=O)n2c1-c1sccc1SCC2 |
| InChI | InChI=1S/C22H23N3O2S2/c1-24(2)10-9-23-21(26)17-14-16(15-6-4-3-5-7-15)22(27)25-11-13-28-18-8-12-29-20(18)19(17)25/h3-8,12,14H,9-11,13H2,1-2H3,(H,23,26) |
| InChIKey | QHUIEQFKCVODCY-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.58 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |