C27H23F7N2O2 — CID 147712380
1-[(3S,4S)-3-(4-fluorophenyl)-4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-methylpyrrolidin-1-yl]-2-pyridin-3-ylethanone (PubChem CID 147712380) has the molecular formula C27H23F7N2O2 and a molecular weight of 540.48 g/mol. Its IUPAC name is 1-[(3S,4S)-3-(4-fluorophenyl)-4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-methylpyrrolidin-1-yl]-2-pyridin-3-ylethanone.
| Compound Name | 1-[(3S,4S)-3-(4-fluorophenyl)-4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-methylpyrrolidin-1-yl]-2-pyridin-3-ylethanone |
|---|---|
| PubChem CID | 147712380 |
| Molecular Formula | C27H23F7N2O2 |
| Molecular Weight | 540.48 g/mol |
| Exact Mass | 540.16 |
| IUPAC Name | 1-[(3S,4S)-3-(4-fluorophenyl)-4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-methylpyrrolidin-1-yl]-2-pyridin-3-ylethanone |
| SMILES | C[C@]1(c2ccc(F)cc2)CN(C(=O)Cc2cccnc2)C[C@H]1c1ccc(C(O)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C27H23F7N2O2/c1-24(19-8-10-21(28)11-9-19)16-36(23(37)13-17-3-2-12-35-14-17)15-22(24)18-4-6-20(7-5-18)25(38,26(29,30)31)27(32,33)34/h2-12,14,22,38H,13,15-16H2,1H3/t22-,24+/m0/s1 |
| InChIKey | GUYUFHZCPURWOO-LADGPHEKSA-N |
| XLogP | 5.66 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.48 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |