C17H23NO3S2 — CID 14772613
(4S)-3-[(2S,3R)-3-hydroxy-2-(phenylsulfanylmethyl)butanoyl]-4-propan-2-yl-1,3-thiazolidin-2-one (PubChem CID 14772613) has the molecular formula C17H23NO3S2 and a molecular weight of 353.51 g/mol. Its IUPAC name is (4S)-3-[(2S,3R)-3-hydroxy-2-(phenylsulfanylmethyl)butanoyl]-4-propan-2-yl-1,3-thiazolidin-2-one.
| Compound Name | (4S)-3-[(2S,3R)-3-hydroxy-2-(phenylsulfanylmethyl)butanoyl]-4-propan-2-yl-1,3-thiazolidin-2-one |
|---|---|
| PubChem CID | 14772613 |
| Molecular Formula | C17H23NO3S2 |
| Molecular Weight | 353.51 g/mol |
| Exact Mass | 353.11 |
| IUPAC Name | (4S)-3-[(2S,3R)-3-hydroxy-2-(phenylsulfanylmethyl)butanoyl]-4-propan-2-yl-1,3-thiazolidin-2-one |
| SMILES | CC(C)[C@H]1CSC(=O)N1C(=O)[C@@H](CSc1ccccc1)[C@@H](C)O |
| InChI | InChI=1S/C17H23NO3S2/c1-11(2)15-10-23-17(21)18(15)16(20)14(12(3)19)9-22-13-7-5-4-6-8-13/h4-8,11-12,14-15,19H,9-10H2,1-3H3/t12-,14+,15-/m1/s1 |
| InChIKey | JCKBSYDYHNIHNC-VHDGCEQUSA-N |
| XLogP | 3.50 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.51 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|