C22H25NO2S2 — CID 101350733
(3S)-3-hydroxy-4,4-diphenyl-1-[(4S)-4-propan-2-yl-2-sulfanylidene-1,3-thiazolidin-3-yl]butan-1-one (PubChem CID 101350733) has the molecular formula C22H25NO2S2 and a molecular weight of 399.58 g/mol. Its IUPAC name is (3S)-3-hydroxy-4,4-diphenyl-1-[(4S)-4-propan-2-yl-2-sulfanylidene-1,3-thiazolidin-3-yl]butan-1-one.
| Compound Name | (3S)-3-hydroxy-4,4-diphenyl-1-[(4S)-4-propan-2-yl-2-sulfanylidene-1,3-thiazolidin-3-yl]butan-1-one |
|---|---|
| PubChem CID | 101350733 |
| Molecular Formula | C22H25NO2S2 |
| Molecular Weight | 399.58 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | (3S)-3-hydroxy-4,4-diphenyl-1-[(4S)-4-propan-2-yl-2-sulfanylidene-1,3-thiazolidin-3-yl]butan-1-one |
| SMILES | CC(C)[C@H]1CSC(=S)N1C(=O)C[C@H](O)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H25NO2S2/c1-15(2)18-14-27-22(26)23(18)20(25)13-19(24)21(16-9-5-3-6-10-16)17-11-7-4-8-12-17/h3-12,15,18-19,21,24H,13-14H2,1-2H3/t18-,19+/m1/s1 |
| InChIKey | FCBCQKIDTILJEY-MOPGFXCFSA-N |
| XLogP | 4.45 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.58 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|