C25H32N2O2S2 — CID 101201395
(2R)-2-[(S)-(4-methoxyanilino)-phenylmethyl]-3-methyl-1-[(4S)-4-propan-2-yl-2-sulfanylidene-1,3-thiazolidin-3-yl]butan-1-one (PubChem CID 101201395) has the molecular formula C25H32N2O2S2 and a molecular weight of 456.68 g/mol. Its IUPAC name is (2R)-2-[(S)-(4-methoxyanilino)-phenylmethyl]-3-methyl-1-[(4S)-4-propan-2-yl-2-sulfanylidene-1,3-thiazolidin-3-yl]butan-1-one.
| Compound Name | (2R)-2-[(S)-(4-methoxyanilino)-phenylmethyl]-3-methyl-1-[(4S)-4-propan-2-yl-2-sulfanylidene-1,3-thiazolidin-3-yl]butan-1-one |
|---|---|
| PubChem CID | 101201395 |
| Molecular Formula | C25H32N2O2S2 |
| Molecular Weight | 456.68 g/mol |
| Exact Mass | 456.19 |
| IUPAC Name | (2R)-2-[(S)-(4-methoxyanilino)-phenylmethyl]-3-methyl-1-[(4S)-4-propan-2-yl-2-sulfanylidene-1,3-thiazolidin-3-yl]butan-1-one |
| SMILES | COc1ccc(N[C@H](c2ccccc2)[C@H](C(=O)N2C(=S)SC[C@@H]2C(C)C)C(C)C)cc1 |
| InChI | InChI=1S/C25H32N2O2S2/c1-16(2)21-15-31-25(30)27(21)24(28)22(17(3)4)23(18-9-7-6-8-10-18)26-19-11-13-20(29-5)14-12-19/h6-14,16-17,21-23,26H,15H2,1-5H3/t21-,22-,23-/m1/s1 |
| InChIKey | LSRCXORAZCMLDH-DNVJHFABSA-N |
| XLogP | 6.01 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.68 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|