C24H26F2N3O9P — CID 147734127
[(2S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-2-(difluoromethyl)-4-hydroxyoxolan-2-yl]methyl bis(4-methoxyphenyl) phosphate (PubChem CID 147734127) has the molecular formula C24H26F2N3O9P and a molecular weight of 569.45 g/mol. Its IUPAC name is [(2S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-2-(difluoromethyl)-4-hydroxyoxolan-2-yl]methyl bis(4-methoxyphenyl) phosphate.
| Compound Name | [(2S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-2-(difluoromethyl)-4-hydroxyoxolan-2-yl]methyl bis(4-methoxyphenyl) phosphate |
|---|---|
| PubChem CID | 147734127 |
| Molecular Formula | C24H26F2N3O9P |
| Molecular Weight | 569.45 g/mol |
| Exact Mass | 569.14 |
| IUPAC Name | [(2S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-2-(difluoromethyl)-4-hydroxyoxolan-2-yl]methyl bis(4-methoxyphenyl) phosphate |
| SMILES | COc1ccc(OP(=O)(OC[C@]2(C(F)F)C[C@@H](O)[C@H](n3ccc(N)nc3=O)O2)Oc2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C24H26F2N3O9P/c1-33-15-3-7-17(8-4-15)37-39(32,38-18-9-5-16(34-2)6-10-18)35-14-24(22(25)26)13-19(30)21(36-24)29-12-11-20(27)28-23(29)31/h3-12,19,21-22,30H,13-14H2,1-2H3,(H2,27,28,31)/t19-,21-,24+/m1/s1 |
| InChIKey | GZABWRAESBPDBG-ZYKOEDHHSA-N |
| XLogP | 3.41 |
| TPSA | 153.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.45 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|