C15H19F3N2O — CID 1477611
(2R)-4-(4-benzylpiperazin-1-yl)-1,1,1-trifluorobut-3-en-2-ol (PubChem CID 1477611) has the molecular formula C15H19F3N2O and a molecular weight of 300.32 g/mol. Its IUPAC name is (2R)-4-(4-benzylpiperazin-1-yl)-1,1,1-trifluorobut-3-en-2-ol.
| Compound Name | (2R)-4-(4-benzylpiperazin-1-yl)-1,1,1-trifluorobut-3-en-2-ol |
|---|---|
| PubChem CID | 1477611 |
| Molecular Formula | C15H19F3N2O |
| Molecular Weight | 300.32 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | (2R)-4-(4-benzylpiperazin-1-yl)-1,1,1-trifluorobut-3-en-2-ol |
| SMILES | O[C@H](C=CN1CCN(Cc2ccccc2)CC1)C(F)(F)F |
| InChI | InChI=1S/C15H19F3N2O/c16-15(17,18)14(21)6-7-19-8-10-20(11-9-19)12-13-4-2-1-3-5-13/h1-7,14,21H,8-12H2/t14-/m1/s1 |
| InChIKey | BPIIBLHCDJCUMX-CQSZACIVSA-N |
| XLogP | 2.24 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.32 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |