C10H8N2O2S — CID 1477852
(E)-3-[1-(1,3-thiazol-2-yl)pyrrol-2-yl]prop-2-enoic acid (PubChem CID 1477852) has the molecular formula C10H8N2O2S and a molecular weight of 220.25 g/mol. Its IUPAC name is (E)-3-[1-(1,3-thiazol-2-yl)pyrrol-2-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[1-(1,3-thiazol-2-yl)pyrrol-2-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 1477852 |
| Molecular Formula | C10H8N2O2S |
| Molecular Weight | 220.25 g/mol |
| Exact Mass | 220.03 |
| IUPAC Name | (E)-3-[1-(1,3-thiazol-2-yl)pyrrol-2-yl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1cccn1-c1nccs1 |
| InChI | InChI=1S/C10H8N2O2S/c13-9(14)4-3-8-2-1-6-12(8)10-11-5-7-15-10/h1-7H,(H,13,14)/b4-3+ |
| InChIKey | YVMCXFFETMPDNB-ONEGZZNKSA-N |
| XLogP | 2.03 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.25 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|