C9H9N5S2 — CID 4209967
[[1-(1,3-thiazol-2-yl)pyrrol-2-yl]methylideneamino]thiourea (PubChem CID 4209967) has the molecular formula C9H9N5S2 and a molecular weight of 251.34 g/mol. Its IUPAC name is [[1-(1,3-thiazol-2-yl)pyrrol-2-yl]methylideneamino]thiourea.
| Compound Name | [[1-(1,3-thiazol-2-yl)pyrrol-2-yl]methylideneamino]thiourea |
|---|---|
| PubChem CID | 4209967 |
| Molecular Formula | C9H9N5S2 |
| Molecular Weight | 251.34 g/mol |
| Exact Mass | 251.03 |
| IUPAC Name | [[1-(1,3-thiazol-2-yl)pyrrol-2-yl]methylideneamino]thiourea |
| SMILES | NC(=S)NN=Cc1cccn1-c1nccs1 |
| InChI | InChI=1S/C9H9N5S2/c10-8(15)13-12-6-7-2-1-4-14(7)9-11-3-5-16-9/h1-6H,(H3,10,13,15) |
| InChIKey | AYAQWGJSZPWJAV-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.34 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_pyrrol(64)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|