C35H39FN8O4 — CID 147786616
2-[(2S,4S,5R)-5-fluoro-2-methyl-1-[(1R)-3-oxocyclopentanecarbonyl]piperidin-4-yl]oxy-5-[4-[4-[4-(oxetan-3-yl)piperazin-1-yl]anilino]-1,3,5-triazin-2-yl]benzonitrile (PubChem CID 147786616) has the molecular formula C35H39FN8O4 and a molecular weight of 654.75 g/mol. Its IUPAC name is 2-[(2S,4S,5R)-5-fluoro-2-methyl-1-[(1R)-3-oxocyclopentanecarbonyl]piperidin-4-yl]oxy-5-[4-[4-[4-(oxetan-3-yl)piperazin-1-yl]anilino]-1,3,5-triazin-2-yl]benzonitrile.
| Compound Name | 2-[(2S,4S,5R)-5-fluoro-2-methyl-1-[(1R)-3-oxocyclopentanecarbonyl]piperidin-4-yl]oxy-5-[4-[4-[4-(oxetan-3-yl)piperazin-1-yl]anilino]-1,3,5-triazin-2-yl]benzonitrile |
|---|---|
| PubChem CID | 147786616 |
| Molecular Formula | C35H39FN8O4 |
| Molecular Weight | 654.75 g/mol |
| Exact Mass | 654.31 |
| IUPAC Name | 2-[(2S,4S,5R)-5-fluoro-2-methyl-1-[(1R)-3-oxocyclopentanecarbonyl]piperidin-4-yl]oxy-5-[4-[4-[4-(oxetan-3-yl)piperazin-1-yl]anilino]-1,3,5-triazin-2-yl]benzonitrile |
| SMILES | C[C@H]1C[C@H](Oc2ccc(-c3ncnc(Nc4ccc(N5CCN(C6COC6)CC5)cc4)n3)cc2C#N)[C@H](F)CN1C(=O)[C@@H]1CCC(=O)C1 |
| InChI | InChI=1S/C35H39FN8O4/c1-22-14-32(30(36)18-44(22)34(46)24-2-8-29(45)16-24)48-31-9-3-23(15-25(31)17-37)33-38-21-39-35(41-33)40-26-4-6-27(7-5-26)42-10-12-43(13-11-42)28-19-47-20-28/h3-7,9,15,21-22,24,28,30,32H,2,8,10-14,16,18-20H2,1H3,(H,38,39,40,41)/t22-,24+,30+,32-/m0/s1 |
| InChIKey | HIUSFNGENUQPON-PPVMQXABSA-N |
| XLogP | 3.75 |
| TPSA | 136.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.75 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|