C9H13NS — CID 147788879
4-methyl-2,3,7,8-tetrahydro-1,4-benzothiazine (PubChem CID 147788879) has the molecular formula C9H13NS and a molecular weight of 167.28 g/mol. Its IUPAC name is 4-methyl-2,3,7,8-tetrahydro-1,4-benzothiazine.
| Compound Name | 4-methyl-2,3,7,8-tetrahydro-1,4-benzothiazine |
|---|---|
| PubChem CID | 147788879 |
| Molecular Formula | C9H13NS |
| Molecular Weight | 167.28 g/mol |
| Exact Mass | 167.08 |
| IUPAC Name | 4-methyl-2,3,7,8-tetrahydro-1,4-benzothiazine |
| SMILES | CN1CCSC2=C1C=CCC2 |
| InChI | InChI=1S/C9H13NS/c1-10-6-7-11-9-5-3-2-4-8(9)10/h2,4H,3,5-7H2,1H3 |
| InChIKey | HJFSVIZAKUOIQB-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.28 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |