C63H49BN4O2 — CID 147802789
2-[3-[1-[3-(4,6-diphenylpyrimidin-2-yl)phenyl]-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-9H-fluoren-3-yl]phenyl]-4,6-diphenylpyrimidine (PubChem CID 147802789) has the molecular formula C63H49BN4O2 and a molecular weight of 904.92 g/mol. Its IUPAC name is 2-[3-[1-[3-(4,6-diphenylpyrimidin-2-yl)phenyl]-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-9H-fluoren-3-yl]phenyl]-4,6-diphenylpyrimidine.
| Compound Name | 2-[3-[1-[3-(4,6-diphenylpyrimidin-2-yl)phenyl]-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-9H-fluoren-3-yl]phenyl]-4,6-diphenylpyrimidine |
|---|---|
| PubChem CID | 147802789 |
| Molecular Formula | C63H49BN4O2 |
| Molecular Weight | 904.92 g/mol |
| Exact Mass | 904.39 |
| IUPAC Name | 2-[3-[1-[3-(4,6-diphenylpyrimidin-2-yl)phenyl]-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-9H-fluoren-3-yl]phenyl]-4,6-diphenylpyrimidine |
| SMILES | CC1(C)OB(c2ccc3c(c2)-c2cc(-c4cccc(-c5nc(-c6ccccc6)cc(-c6ccccc6)n5)c4)cc(-c4cccc(-c5nc(-c6ccccc6)cc(-c6ccccc6)n5)c4)c2C3)OC1(C)C |
| InChI | InChI=1S/C63H49BN4O2/c1-62(2)63(3,4)70-64(69-62)51-32-31-47-35-54-52(46-28-18-30-49(34-46)61-67-58(43-23-13-7-14-24-43)40-59(68-61)44-25-15-8-16-26-44)36-50(37-55(54)53(47)38-51)45-27-17-29-48(33-45)60-65-56(41-19-9-5-10-20-41)39-57(66-60)42-21-11-6-12-22-42/h5-34,36-40H,35H2,1-4H3 |
| InChIKey | HLVLYWDBAHDSFG-UHFFFAOYSA-N |
| XLogP | 14.47 |
| TPSA | 70.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 904.92 |
| LogP ≤ 5 | 14.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|