C32H21F3N2 — CID 123237483
4-ethyl-2-(9,9'-spirobi[fluorene]-2-yl)-6-(trifluoromethyl)pyrimidine (PubChem CID 123237483) has the molecular formula C32H21F3N2 and a molecular weight of 490.53 g/mol. Its IUPAC name is 4-ethyl-2-(9,9'-spirobi[fluorene]-2-yl)-6-(trifluoromethyl)pyrimidine.
| Compound Name | 4-ethyl-2-(9,9'-spirobi[fluorene]-2-yl)-6-(trifluoromethyl)pyrimidine |
|---|---|
| PubChem CID | 123237483 |
| Molecular Formula | C32H21F3N2 |
| Molecular Weight | 490.53 g/mol |
| Exact Mass | 490.17 |
| IUPAC Name | 4-ethyl-2-(9,9'-spirobi[fluorene]-2-yl)-6-(trifluoromethyl)pyrimidine |
| SMILES | CCc1cc(C(F)(F)F)nc(-c2ccc3c(c2)C2(c4ccccc4-c4ccccc42)c2ccccc2-3)n1 |
| InChI | InChI=1S/C32H21F3N2/c1-2-20-18-29(32(33,34)35)37-30(36-20)19-15-16-24-23-11-5-8-14-27(23)31(28(24)17-19)25-12-6-3-9-21(25)22-10-4-7-13-26(22)31/h3-18H,2H2,1H3 |
| InChIKey | LUBOGRUDVGLXHL-UHFFFAOYSA-N |
| XLogP | 8.07 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.53 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |