About naphthalen-1-ylmethyl 3-phenylprop-2-ynoate
naphthalen-1-ylmethyl 3-phenylprop-2-ynoate (PubChem CID 14782739) has the molecular formula C20H14O2
and a molecular weight of 286.33 g/mol. Its IUPAC name is naphthalen-1-ylmethyl 3-phenylprop-2-ynoate.
Molecular Properties
| Compound Name | naphthalen-1-ylmethyl 3-phenylprop-2-ynoate |
| PubChem CID | 14782739 |
| Molecular Formula | C20H14O2 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | naphthalen-1-ylmethyl 3-phenylprop-2-ynoate |
| SMILES | O=C(C#Cc1ccccc1)OCc1cccc2ccccc12 |
| InChI | InChI=1S/C20H14O2/c21-20(14-13-16-7-2-1-3-8-16)22-15-18-11-6-10-17-9-4-5-12-19(17)18/h1-12H,15H2 |
| InChIKey | WLHUOURDEMIZSW-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze naphthalen-1-ylmethyl 3-phenylprop-2-ynoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of naphthalen-1-ylmethyl 3-phenylprop-2-ynoate?
The IUPAC name of naphthalen-1-ylmethyl 3-phenylprop-2-ynoate (CID 14782739) is naphthalen-1-ylmethyl 3-phenylprop-2-ynoate.
What is the SMILES notation for naphthalen-1-ylmethyl 3-phenylprop-2-ynoate?
The canonical SMILES for naphthalen-1-ylmethyl 3-phenylprop-2-ynoate is O=C(C#Cc1ccccc1)OCc1cccc2ccccc12.
What is the InChIKey of naphthalen-1-ylmethyl 3-phenylprop-2-ynoate?
The InChIKey is WLHUOURDEMIZSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H14O2/c21-20(14-13-16-7-2-1-3-8-16)22-15-18-11-6-10-17-9-4-5-12-19(17)18/h1-12H,15H2.
What are the key properties of naphthalen-1-ylmethyl 3-phenylprop-2-ynoate?
naphthalen-1-ylmethyl 3-phenylprop-2-ynoate has a molecular weight of 286.33 g/mol, XLogP of 3.93, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for naphthalen-1-ylmethyl 3-phenylprop-2-ynoate is sourced from PubChem (CID 14782739), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).