C26H19ClN2O2 — CID 147835638
N-[(7-chloro-4-oxo-1-phenylquinolin-3-yl)methyl]-3H-indene-5-carboxamide (PubChem CID 147835638) has the molecular formula C26H19ClN2O2 and a molecular weight of 426.90 g/mol. Its IUPAC name is N-[(7-chloro-4-oxo-1-phenylquinolin-3-yl)methyl]-3H-indene-5-carboxamide.
| Compound Name | N-[(7-chloro-4-oxo-1-phenylquinolin-3-yl)methyl]-3H-indene-5-carboxamide |
|---|---|
| PubChem CID | 147835638 |
| Molecular Formula | C26H19ClN2O2 |
| Molecular Weight | 426.90 g/mol |
| Exact Mass | 426.11 |
| IUPAC Name | N-[(7-chloro-4-oxo-1-phenylquinolin-3-yl)methyl]-3H-indene-5-carboxamide |
| SMILES | O=C(NCc1cn(-c2ccccc2)c2cc(Cl)ccc2c1=O)c1ccc2c(c1)CC=C2 |
| InChI | InChI=1S/C26H19ClN2O2/c27-21-11-12-23-24(14-21)29(22-7-2-1-3-8-22)16-20(25(23)30)15-28-26(31)19-10-9-17-5-4-6-18(17)13-19/h1-5,7-14,16H,6,15H2,(H,28,31) |
| InChIKey | HRYHYPRFQSQUQJ-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.90 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |