C29H30ClN3O3 — CID 123428318
1-[(7-chloro-4-oxo-1-phenylquinolin-3-yl)methyl]-3-(5-hydroxy-5,7-dimethyl-2-tricyclo[5.2.1.03,9]dec-3-enyl)urea (PubChem CID 123428318) has the molecular formula C29H30ClN3O3 and a molecular weight of 504.03 g/mol. Its IUPAC name is 1-[(7-chloro-4-oxo-1-phenylquinolin-3-yl)methyl]-3-(5-hydroxy-5,7-dimethyl-2-tricyclo[5.2.1.03,9]dec-3-enyl)urea.
| Compound Name | 1-[(7-chloro-4-oxo-1-phenylquinolin-3-yl)methyl]-3-(5-hydroxy-5,7-dimethyl-2-tricyclo[5.2.1.03,9]dec-3-enyl)urea |
|---|---|
| PubChem CID | 123428318 |
| Molecular Formula | C29H30ClN3O3 |
| Molecular Weight | 504.03 g/mol |
| Exact Mass | 503.20 |
| IUPAC Name | 1-[(7-chloro-4-oxo-1-phenylquinolin-3-yl)methyl]-3-(5-hydroxy-5,7-dimethyl-2-tricyclo[5.2.1.03,9]dec-3-enyl)urea |
| SMILES | CC1(O)C=C2C3CC(C)(CC3C2NC(=O)NCc2cn(-c3ccccc3)c3cc(Cl)ccc3c2=O)C1 |
| InChI | InChI=1S/C29H30ClN3O3/c1-28-11-21-22(12-28)25(23(21)13-29(2,36)16-28)32-27(35)31-14-17-15-33(19-6-4-3-5-7-19)24-10-18(30)8-9-20(24)26(17)34/h3-10,13,15,21-22,25,36H,11-12,14,16H2,1-2H3,(H2,31,32,35) |
| InChIKey | KPNUIIVXSGJWSB-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 83.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.03 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|