C47H35Cl3N6O9 — CID 157362753
3-(aminomethyl)-7-chloro-1-phenylquinolin-4-one;2-(4-nitrophenyl)acetyl chloride;(4-nitrophenyl) N-[(7-chloro-4-oxo-1-phenylquinolin-3-yl)methyl]carbamate (PubChem CID 157362753) has the molecular formula C47H35Cl3N6O9 and a molecular weight of 934.19 g/mol. Its IUPAC name is 3-(aminomethyl)-7-chloro-1-phenylquinolin-4-one;2-(4-nitrophenyl)acetyl chloride;(4-nitrophenyl) N-[(7-chloro-4-oxo-1-phenylquinolin-3-yl)methyl]carbamate.
| Compound Name | 3-(aminomethyl)-7-chloro-1-phenylquinolin-4-one;2-(4-nitrophenyl)acetyl chloride;(4-nitrophenyl) N-[(7-chloro-4-oxo-1-phenylquinolin-3-yl)methyl]carbamate |
|---|---|
| PubChem CID | 157362753 |
| Molecular Formula | C47H35Cl3N6O9 |
| Molecular Weight | 934.19 g/mol |
| Exact Mass | 932.15 |
| IUPAC Name | 3-(aminomethyl)-7-chloro-1-phenylquinolin-4-one;2-(4-nitrophenyl)acetyl chloride;(4-nitrophenyl) N-[(7-chloro-4-oxo-1-phenylquinolin-3-yl)methyl]carbamate |
| SMILES | NCc1cn(-c2ccccc2)c2cc(Cl)ccc2c1=O.O=C(Cl)Cc1ccc([N+](=O)[O-])cc1.O=C(NCc1cn(-c2ccccc2)c2cc(Cl)ccc2c1=O)Oc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C23H16ClN3O5.C16H13ClN2O.C8H6ClNO3/c24-16-6-11-20-21(12-16)26(17-4-2-1-3-5-17)14-15(22(20)28)13-25-23(29)32-19-9-7-18(8-10-19)27(30)31;17-12-6-7-14-15(8-12)19(10-11(9-18)16(14)20)13-4-2-1-3-5-13;9-8(11)5-6-1-3-7(4-2-6)10(12)13/h1-12,14H,13H2,(H,25,29);1-8,10H,9,18H2;1-4H,5H2 |
| InChIKey | BIVFVHKXOZXWRI-UHFFFAOYSA-N |
| XLogP | 9.85 |
| TPSA | 211.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 65 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 934.19 |
| LogP ≤ 5 | 9.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|