C8H13N3O — CID 147862348
4-ethoxy-5,6-dimethylpyrimidin-2-amine (PubChem CID 147862348) has the molecular formula C8H13N3O and a molecular weight of 167.21 g/mol. Its IUPAC name is 4-ethoxy-5,6-dimethylpyrimidin-2-amine.
| Compound Name | 4-ethoxy-5,6-dimethylpyrimidin-2-amine |
|---|---|
| PubChem CID | 147862348 |
| Molecular Formula | C8H13N3O |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.11 |
| IUPAC Name | 4-ethoxy-5,6-dimethylpyrimidin-2-amine |
| SMILES | CCOc1nc(N)nc(C)c1C |
| InChI | InChI=1S/C8H13N3O/c1-4-12-7-5(2)6(3)10-8(9)11-7/h4H2,1-3H3,(H2,9,10,11) |
| InChIKey | HWYMGPLXXPCNFR-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |