C30H41F2O8S2+ — CID 147877283
1,1-difluoro-2-[3-[4-(4-methoxyphenyl)-2,2-dimethyl-3-(1,4-oxathian-4-ium-4-yl)-4-oxobutyl]adamantane-1-carbonyl]oxyethanesulfonic acid (PubChem CID 147877283) has the molecular formula C30H41F2O8S2+ and a molecular weight of 631.78 g/mol. Its IUPAC name is 1,1-difluoro-2-[3-[4-(4-methoxyphenyl)-2,2-dimethyl-3-(1,4-oxathian-4-ium-4-yl)-4-oxobutyl]adamantane-1-carbonyl]oxyethanesulfonic acid.
| Compound Name | 1,1-difluoro-2-[3-[4-(4-methoxyphenyl)-2,2-dimethyl-3-(1,4-oxathian-4-ium-4-yl)-4-oxobutyl]adamantane-1-carbonyl]oxyethanesulfonic acid |
|---|---|
| PubChem CID | 147877283 |
| Molecular Formula | C30H41F2O8S2+ |
| Molecular Weight | 631.78 g/mol |
| Exact Mass | 631.22 |
| IUPAC Name | 1,1-difluoro-2-[3-[4-(4-methoxyphenyl)-2,2-dimethyl-3-(1,4-oxathian-4-ium-4-yl)-4-oxobutyl]adamantane-1-carbonyl]oxyethanesulfonic acid |
| SMILES | COc1ccc(C(=O)C([S+]2CCOCC2)C(C)(C)CC23CC4CC(C2)CC(C(=O)OCC(F)(F)S(=O)(=O)O)(C4)C3)cc1 |
| InChI | InChI=1S/C30H40F2O8S2/c1-27(2,25(41-10-8-39-9-11-41)24(33)22-4-6-23(38-3)7-5-22)17-28-13-20-12-21(14-28)16-29(15-20,18-28)26(34)40-19-30(31,32)42(35,36)37/h4-7,20-21,25H,8-19H2,1-3H3/p+1 |
| InChIKey | HZTPNMKAVZJYFN-UHFFFAOYSA-O |
| XLogP | 4.92 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.78 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|