C32H44F2O8S2 — CID 123249492
2-[4-[4-(2,3-dihydro-1-benzofuran-5-yl)-2,2-dimethyl-3-(4-methyl-1,4-oxathian-4-yl)-4-oxobutyl]adamantane-1-carbonyl]oxy-1,1-difluoroethanesulfonic acid (PubChem CID 123249492) has the molecular formula C32H44F2O8S2 and a molecular weight of 658.83 g/mol. Its IUPAC name is 2-[4-[4-(2,3-dihydro-1-benzofuran-5-yl)-2,2-dimethyl-3-(4-methyl-1,4-oxathian-4-yl)-4-oxobutyl]adamantane-1-carbonyl]oxy-1,1-difluoroethanesulfonic acid.
| Compound Name | 2-[4-[4-(2,3-dihydro-1-benzofuran-5-yl)-2,2-dimethyl-3-(4-methyl-1,4-oxathian-4-yl)-4-oxobutyl]adamantane-1-carbonyl]oxy-1,1-difluoroethanesulfonic acid |
|---|---|
| PubChem CID | 123249492 |
| Molecular Formula | C32H44F2O8S2 |
| Molecular Weight | 658.83 g/mol |
| Exact Mass | 658.24 |
| IUPAC Name | 2-[4-[4-(2,3-dihydro-1-benzofuran-5-yl)-2,2-dimethyl-3-(4-methyl-1,4-oxathian-4-yl)-4-oxobutyl]adamantane-1-carbonyl]oxy-1,1-difluoroethanesulfonic acid |
| SMILES | CC(C)(CC1C2CC3CC1CC(C(=O)OCC(F)(F)S(=O)(=O)O)(C3)C2)C(C(=O)c1ccc2c(c1)CCO2)S1(C)CCOCC1 |
| InChI | InChI=1S/C32H44F2O8S2/c1-30(2,28(43(3)10-8-40-9-11-43)27(35)22-4-5-26-21(14-22)6-7-41-26)18-25-23-12-20-13-24(25)17-31(15-20,16-23)29(36)42-19-32(33,34)44(37,38)39/h4-5,14,20,23-25,28H,6-13,15-19H2,1-3H3,(H,37,38,39) |
| InChIKey | OMLGHYMEYXYTJN-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.83 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|