C21H34O2 — CID 147883269
(5-methyl-10-propan-2-yl-10-tricyclo[5.2.1.03,9]dec-3-enyl) 2,2-dimethylpentanoate (PubChem CID 147883269) has the molecular formula C21H34O2 and a molecular weight of 318.50 g/mol. Its IUPAC name is (5-methyl-10-propan-2-yl-10-tricyclo[5.2.1.03,9]dec-3-enyl) 2,2-dimethylpentanoate.
| Compound Name | (5-methyl-10-propan-2-yl-10-tricyclo[5.2.1.03,9]dec-3-enyl) 2,2-dimethylpentanoate |
|---|---|
| PubChem CID | 147883269 |
| Molecular Formula | C21H34O2 |
| Molecular Weight | 318.50 g/mol |
| Exact Mass | 318.26 |
| IUPAC Name | (5-methyl-10-propan-2-yl-10-tricyclo[5.2.1.03,9]dec-3-enyl) 2,2-dimethylpentanoate |
| SMILES | CCCC(C)(C)C(=O)OC1(C(C)C)C2CC(C)C=C3CC1C3C2 |
| InChI | InChI=1S/C21H34O2/c1-7-8-20(5,6)19(22)23-21(13(2)3)16-10-14(4)9-15-11-18(21)17(15)12-16/h9,13-14,16-18H,7-8,10-12H2,1-6H3 |
| InChIKey | IAVQWHYGLYSOCU-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.50 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|