About 6-oxabicyclo[3.1.1]heptan-3-ylmethyl 2,2-dimethylpentanoate
6-oxabicyclo[3.1.1]heptan-3-ylmethyl 2,2-dimethylpentanoate (PubChem CID 146650209) has the molecular formula C14H24O3
and a molecular weight of 240.34 g/mol. Its IUPAC name is 6-oxabicyclo[3.1.1]heptan-3-ylmethyl 2,2-dimethylpentanoate.
Analyze 6-oxabicyclo[3.1.1]heptan-3-ylmethyl 2,2-dimethylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-oxabicyclo[3.1.1]heptan-3-ylmethyl 2,2-dimethylpentanoate?
The IUPAC name of 6-oxabicyclo[3.1.1]heptan-3-ylmethyl 2,2-dimethylpentanoate (CID 146650209) is 6-oxabicyclo[3.1.1]heptan-3-ylmethyl 2,2-dimethylpentanoate.
What is the SMILES notation for 6-oxabicyclo[3.1.1]heptan-3-ylmethyl 2,2-dimethylpentanoate?
The canonical SMILES for 6-oxabicyclo[3.1.1]heptan-3-ylmethyl 2,2-dimethylpentanoate is CCCC(C)(C)C(=O)OCC1CC2CC(C1)O2.
What is the InChIKey of 6-oxabicyclo[3.1.1]heptan-3-ylmethyl 2,2-dimethylpentanoate?
The InChIKey is ZVRARKHETAGXPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24O3/c1-4-5-14(2,3)13(15)16-9-10-6-11-8-12(7-10)17-11/h10-12H,4-9H2,1-3H3.
What are the key properties of 6-oxabicyclo[3.1.1]heptan-3-ylmethyl 2,2-dimethylpentanoate?
6-oxabicyclo[3.1.1]heptan-3-ylmethyl 2,2-dimethylpentanoate has a molecular weight of 240.34 g/mol, XLogP of 2.92, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-oxabicyclo[3.1.1]heptan-3-ylmethyl 2,2-dimethylpentanoate is sourced from PubChem (CID 146650209), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).