C22H24N6O2 — CID 147933467
1-[3-amino-6-(2-methoxypyrimidin-5-yl)pyrazin-2-yl]-2-(2-piperidin-1-ylphenyl)ethanone (PubChem CID 147933467) has the molecular formula C22H24N6O2 and a molecular weight of 404.47 g/mol. Its IUPAC name is 1-[3-amino-6-(2-methoxypyrimidin-5-yl)pyrazin-2-yl]-2-(2-piperidin-1-ylphenyl)ethanone.
| Compound Name | 1-[3-amino-6-(2-methoxypyrimidin-5-yl)pyrazin-2-yl]-2-(2-piperidin-1-ylphenyl)ethanone |
|---|---|
| PubChem CID | 147933467 |
| Molecular Formula | C22H24N6O2 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | 1-[3-amino-6-(2-methoxypyrimidin-5-yl)pyrazin-2-yl]-2-(2-piperidin-1-ylphenyl)ethanone |
| SMILES | COc1ncc(-c2cnc(N)c(C(=O)Cc3ccccc3N3CCCCC3)n2)cn1 |
| InChI | InChI=1S/C22H24N6O2/c1-30-22-25-12-16(13-26-22)17-14-24-21(23)20(27-17)19(29)11-15-7-3-4-8-18(15)28-9-5-2-6-10-28/h3-4,7-8,12-14H,2,5-6,9-11H2,1H3,(H2,23,24) |
| InChIKey | IKIFMKJUCQUDCJ-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 107.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |