C36H47FO5 — CID 14793752
decyl 6-[4-(2-fluorooctoxy)benzoyl]oxynaphthalene-2-carboxylate (PubChem CID 14793752) has the molecular formula C36H47FO5 and a molecular weight of 578.77 g/mol. Its IUPAC name is decyl 6-[4-(2-fluorooctoxy)benzoyl]oxynaphthalene-2-carboxylate.
| Compound Name | decyl 6-[4-(2-fluorooctoxy)benzoyl]oxynaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 14793752 |
| Molecular Formula | C36H47FO5 |
| Molecular Weight | 578.77 g/mol |
| Exact Mass | 578.34 |
| IUPAC Name | decyl 6-[4-(2-fluorooctoxy)benzoyl]oxynaphthalene-2-carboxylate |
| SMILES | CCCCCCCCCCOC(=O)c1ccc2cc(OC(=O)c3ccc(OCC(F)CCCCCC)cc3)ccc2c1 |
| InChI | InChI=1S/C36H47FO5/c1-3-5-7-9-10-11-12-14-24-40-35(38)31-17-16-30-26-34(23-20-29(30)25-31)42-36(39)28-18-21-33(22-19-28)41-27-32(37)15-13-8-6-4-2/h16-23,25-26,32H,3-15,24,27H2,1-2H3 |
| InChIKey | LXSQTNOYEZJWQA-UHFFFAOYSA-N |
| XLogP | 10.04 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.77 |
| LogP ≤ 5 | 10.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|