C24H18ClFN2O2 — CID 147943179
(3S)-1-(3-chloro-4-isocyanophenyl)-4-(3-fluorocarbazol-9-yl)-3-hydroxy-3-methylbutan-2-one (PubChem CID 147943179) has the molecular formula C24H18ClFN2O2 and a molecular weight of 420.87 g/mol. Its IUPAC name is (3S)-1-(3-chloro-4-isocyanophenyl)-4-(3-fluorocarbazol-9-yl)-3-hydroxy-3-methylbutan-2-one.
| Compound Name | (3S)-1-(3-chloro-4-isocyanophenyl)-4-(3-fluorocarbazol-9-yl)-3-hydroxy-3-methylbutan-2-one |
|---|---|
| PubChem CID | 147943179 |
| Molecular Formula | C24H18ClFN2O2 |
| Molecular Weight | 420.87 g/mol |
| Exact Mass | 420.10 |
| IUPAC Name | (3S)-1-(3-chloro-4-isocyanophenyl)-4-(3-fluorocarbazol-9-yl)-3-hydroxy-3-methylbutan-2-one |
| SMILES | [C-]#[N+]c1ccc(CC(=O)[C@@](C)(O)Cn2c3ccccc3c3cc(F)ccc32)cc1Cl |
| InChI | InChI=1S/C24H18ClFN2O2/c1-24(30,23(29)12-15-7-9-20(27-2)19(25)11-15)14-28-21-6-4-3-5-17(21)18-13-16(26)8-10-22(18)28/h3-11,13,30H,12,14H2,1H3/t24-/m0/s1 |
| InChIKey | IMDQQKQWRROQDP-DEOSSOPVSA-N |
| XLogP | 5.70 |
| TPSA | 46.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.87 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|