C14H28O2 — CID 147950390
1-cyclohexyloxy-2,2,3,3-tetramethylbutan-1-ol (PubChem CID 147950390) has the molecular formula C14H28O2 and a molecular weight of 228.38 g/mol. Its IUPAC name is 1-cyclohexyloxy-2,2,3,3-tetramethylbutan-1-ol.
| Compound Name | 1-cyclohexyloxy-2,2,3,3-tetramethylbutan-1-ol |
|---|---|
| PubChem CID | 147950390 |
| Molecular Formula | C14H28O2 |
| Molecular Weight | 228.38 g/mol |
| Exact Mass | 228.21 |
| IUPAC Name | 1-cyclohexyloxy-2,2,3,3-tetramethylbutan-1-ol |
| SMILES | CC(C)(C)C(C)(C)C(O)OC1CCCCC1 |
| InChI | InChI=1S/C14H28O2/c1-13(2,3)14(4,5)12(15)16-11-9-7-6-8-10-11/h11-12,15H,6-10H2,1-5H3 |
| InChIKey | INMOGTSAUAPNNO-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.38 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|