C14H28O2 — CID 97304791
(1S,2R)-1-cyclohexyloxy-2-ethyl-3,3-dimethylbutan-1-ol (PubChem CID 97304791) has the molecular formula C14H28O2 and a molecular weight of 228.38 g/mol. Its IUPAC name is (1S,2R)-1-cyclohexyloxy-2-ethyl-3,3-dimethylbutan-1-ol.
| Compound Name | (1S,2R)-1-cyclohexyloxy-2-ethyl-3,3-dimethylbutan-1-ol |
|---|---|
| PubChem CID | 97304791 |
| Molecular Formula | C14H28O2 |
| Molecular Weight | 228.38 g/mol |
| Exact Mass | 228.21 |
| IUPAC Name | (1S,2R)-1-cyclohexyloxy-2-ethyl-3,3-dimethylbutan-1-ol |
| SMILES | CC[C@@H]([C@@H](O)OC1CCCCC1)C(C)(C)C |
| InChI | InChI=1S/C14H28O2/c1-5-12(14(2,3)4)13(15)16-11-9-7-6-8-10-11/h11-13,15H,5-10H2,1-4H3/t12-,13-/m0/s1 |
| InChIKey | HRZAPRPOXOJRII-STQMWFEESA-N |
| XLogP | 3.73 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.38 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|