C7H5NO3 — CID 14796871
7-hydroxy-7H-furo[3,4-b]pyridin-5-one (PubChem CID 14796871) has the molecular formula C7H5NO3 and a molecular weight of 151.12 g/mol. Its IUPAC name is 7-hydroxy-7H-furo[3,4-b]pyridin-5-one.
| Compound Name | 7-hydroxy-7H-furo[3,4-b]pyridin-5-one |
|---|---|
| PubChem CID | 14796871 |
| Molecular Formula | C7H5NO3 |
| Molecular Weight | 151.12 g/mol |
| Exact Mass | 151.03 |
| IUPAC Name | 7-hydroxy-7H-furo[3,4-b]pyridin-5-one |
| SMILES | O=C1OC(O)c2ncccc21 |
| InChI | InChI=1S/C7H5NO3/c9-6-4-2-1-3-8-5(4)7(10)11-6/h1-3,7,10H |
| InChIKey | HRDCCAZUGXDDEB-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.12 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |