C19H34Cl3CrN3OP+ — CID 147989964
[[N-(methylamino)-C-(4-methylphenyl)carbonimidoyl]amino]-di(propan-2-yl)phosphanium;2,3,4,5-tetrahydrofuran-5-ide;trichlorochromium(1+) (PubChem CID 147989964) has the molecular formula C19H34Cl3CrN3OP+ and a molecular weight of 509.83 g/mol. Its IUPAC name is [[N-(methylamino)-C-(4-methylphenyl)carbonimidoyl]amino]-di(propan-2-yl)phosphanium;2,3,4,5-tetrahydrofuran-5-ide;trichlorochromium(1+).
| Compound Name | [[N-(methylamino)-C-(4-methylphenyl)carbonimidoyl]amino]-di(propan-2-yl)phosphanium;2,3,4,5-tetrahydrofuran-5-ide;trichlorochromium(1+) |
|---|---|
| PubChem CID | 147989964 |
| Molecular Formula | C19H34Cl3CrN3OP+ |
| Molecular Weight | 509.83 g/mol |
| Exact Mass | 508.09 |
| IUPAC Name | [[N-(methylamino)-C-(4-methylphenyl)carbonimidoyl]amino]-di(propan-2-yl)phosphanium;2,3,4,5-tetrahydrofuran-5-ide;trichlorochromium(1+) |
| SMILES | CNN=C(N[PH+](C(C)C)C(C)C)c1ccc(C)cc1.Cl[Cr+](Cl)Cl.[CH-]1CCCO1 |
| InChI | InChI=1S/C15H26N3P.C4H7O.3ClH.Cr/c1-11(2)19(12(3)4)18-15(17-16-6)14-9-7-13(5)8-10-14;1-2-4-5-3-1;;;;/h7-12,16H,1-6H3,(H,17,18);3H,1-2,4H2;3*1H;/q;-1;;;;+4/p-2 |
| InChIKey | RPIDRTBHDLIGMA-UHFFFAOYSA-L |
| XLogP | 6.44 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.83 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|