C28H43Cl3CrN2OP+ — CID 140602053
[[N-(4-tert-butyl-2,6-dimethylphenyl)-C-(4-methylphenyl)carbonimidoyl]amino]-diethylphosphanium;2,3,4,5-tetrahydrofuran-5-ide;trichlorochromium(1+) (PubChem CID 140602053) has the molecular formula C28H43Cl3CrN2OP+ and a molecular weight of 612.99 g/mol. Its IUPAC name is [[N-(4-tert-butyl-2,6-dimethylphenyl)-C-(4-methylphenyl)carbonimidoyl]amino]-diethylphosphanium;2,3,4,5-tetrahydrofuran-5-ide;trichlorochromium(1+).
| Compound Name | [[N-(4-tert-butyl-2,6-dimethylphenyl)-C-(4-methylphenyl)carbonimidoyl]amino]-diethylphosphanium;2,3,4,5-tetrahydrofuran-5-ide;trichlorochromium(1+) |
|---|---|
| PubChem CID | 140602053 |
| Molecular Formula | C28H43Cl3CrN2OP+ |
| Molecular Weight | 612.99 g/mol |
| Exact Mass | 611.16 |
| IUPAC Name | [[N-(4-tert-butyl-2,6-dimethylphenyl)-C-(4-methylphenyl)carbonimidoyl]amino]-diethylphosphanium;2,3,4,5-tetrahydrofuran-5-ide;trichlorochromium(1+) |
| SMILES | CC[PH+](CC)N/C(=N/c1c(C)cc(C(C)(C)C)cc1C)c1ccc(C)cc1.Cl[Cr+](Cl)Cl.[CH-]1CCCO1 |
| InChI | InChI=1S/C24H35N2P.C4H7O.3ClH.Cr/c1-9-27(10-2)26-23(20-13-11-17(3)12-14-20)25-22-18(4)15-21(16-19(22)5)24(6,7)8;1-2-4-5-3-1;;;;/h11-16H,9-10H2,1-8H3,(H,25,26);3H,1-2,4H2;3*1H;/q;-1;;;;+4/p-2 |
| InChIKey | IEYFQZGVRZEFLH-UHFFFAOYSA-L |
| XLogP | 9.77 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.99 |
| LogP ≤ 5 | 9.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|