C19H36N4O4Si — CID 14805109
tert-butyl (3aR,4S,5S,7S)-4-acetamido-5-[tert-butyl(dimethyl)silyl]oxy-3,3a,4,5,6,7-hexahydrotriazolo[1,5-a]pyridine-7-carboxylate (PubChem CID 14805109) has the molecular formula C19H36N4O4Si and a molecular weight of 412.61 g/mol. Its IUPAC name is tert-butyl (3aR,4S,5S,7S)-4-acetamido-5-[tert-butyl(dimethyl)silyl]oxy-3,3a,4,5,6,7-hexahydrotriazolo[1,5-a]pyridine-7-carboxylate.
| Compound Name | tert-butyl (3aR,4S,5S,7S)-4-acetamido-5-[tert-butyl(dimethyl)silyl]oxy-3,3a,4,5,6,7-hexahydrotriazolo[1,5-a]pyridine-7-carboxylate |
|---|---|
| PubChem CID | 14805109 |
| Molecular Formula | C19H36N4O4Si |
| Molecular Weight | 412.61 g/mol |
| Exact Mass | 412.25 |
| IUPAC Name | tert-butyl (3aR,4S,5S,7S)-4-acetamido-5-[tert-butyl(dimethyl)silyl]oxy-3,3a,4,5,6,7-hexahydrotriazolo[1,5-a]pyridine-7-carboxylate |
| SMILES | CC(=O)N[C@@H]1[C@@H](O[Si](C)(C)C(C)(C)C)C[C@@H](C(=O)OC(C)(C)C)N2N=NC[C@H]12 |
| InChI | InChI=1S/C19H36N4O4Si/c1-12(24)21-16-14-11-20-22-23(14)13(17(25)26-18(2,3)4)10-15(16)27-28(8,9)19(5,6)7/h13-16H,10-11H2,1-9H3,(H,21,24)/t13-,14+,15-,16-/m0/s1 |
| InChIKey | GEHKHYZUTFIGCF-FZKCQIBNSA-N |
| XLogP | 3.05 |
| TPSA | 92.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.61 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|