C21H32O — CID 14807434
1-[(3E,5aR,6R,9aS)-6,9a-dimethyl-3-(2-methylpropylidene)-1,2,4,5,5a,7,8,9-octahydrocyclopenta[a]naphthalen-6-yl]ethanone (PubChem CID 14807434) has the molecular formula C21H32O and a molecular weight of 300.49 g/mol. Its IUPAC name is 1-[(3E,5aR,6R,9aS)-6,9a-dimethyl-3-(2-methylpropylidene)-1,2,4,5,5a,7,8,9-octahydrocyclopenta[a]naphthalen-6-yl]ethanone.
| Compound Name | 1-[(3E,5aR,6R,9aS)-6,9a-dimethyl-3-(2-methylpropylidene)-1,2,4,5,5a,7,8,9-octahydrocyclopenta[a]naphthalen-6-yl]ethanone |
|---|---|
| PubChem CID | 14807434 |
| Molecular Formula | C21H32O |
| Molecular Weight | 300.49 g/mol |
| Exact Mass | 300.25 |
| IUPAC Name | 1-[(3E,5aR,6R,9aS)-6,9a-dimethyl-3-(2-methylpropylidene)-1,2,4,5,5a,7,8,9-octahydrocyclopenta[a]naphthalen-6-yl]ethanone |
| SMILES | CC(=O)[C@]1(C)CCC[C@]2(C)C3=C(CC[C@@H]12)/C(=C/C(C)C)CC3 |
| InChI | InChI=1S/C21H32O/c1-14(2)13-16-7-9-18-17(16)8-10-19-20(4,15(3)22)11-6-12-21(18,19)5/h13-14,19H,6-12H2,1-5H3/b16-13+/t19-,20-,21+/m0/s1 |
| InChIKey | DFYVWRYRTUFYSI-HKJCZRKDSA-N |
| XLogP | 5.85 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.49 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |