C21H34 — CID 14807438
(3E,5aS,6R,9aS)-6-ethyl-6,9a-dimethyl-3-(2-methylpropylidene)-1,2,4,5,5a,7,8,9-octahydrocyclopenta[a]naphthalene (PubChem CID 14807438) has the molecular formula C21H34 and a molecular weight of 286.50 g/mol. Its IUPAC name is (3E,5aS,6R,9aS)-6-ethyl-6,9a-dimethyl-3-(2-methylpropylidene)-1,2,4,5,5a,7,8,9-octahydrocyclopenta[a]naphthalene.
| Compound Name | (3E,5aS,6R,9aS)-6-ethyl-6,9a-dimethyl-3-(2-methylpropylidene)-1,2,4,5,5a,7,8,9-octahydrocyclopenta[a]naphthalene |
|---|---|
| PubChem CID | 14807438 |
| Molecular Formula | C21H34 |
| Molecular Weight | 286.50 g/mol |
| Exact Mass | 286.27 |
| IUPAC Name | (3E,5aS,6R,9aS)-6-ethyl-6,9a-dimethyl-3-(2-methylpropylidene)-1,2,4,5,5a,7,8,9-octahydrocyclopenta[a]naphthalene |
| SMILES | CC[C@]1(C)CCC[C@]2(C)C3=C(CC[C@@H]12)/C(=C/C(C)C)CC3 |
| InChI | InChI=1S/C21H34/c1-6-20(4)12-7-13-21(5)18-10-8-16(14-15(2)3)17(18)9-11-19(20)21/h14-15,19H,6-13H2,1-5H3/b16-14+/t19-,20+,21+/m0/s1 |
| InChIKey | YAECOZZXSWDQHC-JMTYIHSJSA-N |
| XLogP | 6.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.50 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |