C14H23NO3 — CID 14822574
[2-methylidene-4-(4,4,6-trimethyl-5,6-dihydro-1,3-oxazin-2-yl)butyl] acetate (PubChem CID 14822574) has the molecular formula C14H23NO3 and a molecular weight of 253.34 g/mol. Its IUPAC name is [2-methylidene-4-(4,4,6-trimethyl-5,6-dihydro-1,3-oxazin-2-yl)butyl] acetate.
| Compound Name | [2-methylidene-4-(4,4,6-trimethyl-5,6-dihydro-1,3-oxazin-2-yl)butyl] acetate |
|---|---|
| PubChem CID | 14822574 |
| Molecular Formula | C14H23NO3 |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.17 |
| IUPAC Name | [2-methylidene-4-(4,4,6-trimethyl-5,6-dihydro-1,3-oxazin-2-yl)butyl] acetate |
| SMILES | C=C(CCC1=NC(C)(C)CC(C)O1)COC(C)=O |
| InChI | InChI=1S/C14H23NO3/c1-10(9-17-12(3)16)6-7-13-15-14(4,5)8-11(2)18-13/h11H,1,6-9H2,2-5H3 |
| InChIKey | HUKGDIJMFADKLJ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|