About (6R)-2,4,4,6-tetramethyl-5,6-dihydro-1,3-oxazine
(6R)-2,4,4,6-tetramethyl-5,6-dihydro-1,3-oxazine (PubChem CID 7004113) has the molecular formula C8H15NO
and a molecular weight of 141.21 g/mol. Its IUPAC name is (6R)-2,4,4,6-tetramethyl-5,6-dihydro-1,3-oxazine.
Analyze (6R)-2,4,4,6-tetramethyl-5,6-dihydro-1,3-oxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6R)-2,4,4,6-tetramethyl-5,6-dihydro-1,3-oxazine?
The IUPAC name of (6R)-2,4,4,6-tetramethyl-5,6-dihydro-1,3-oxazine (CID 7004113) is (6R)-2,4,4,6-tetramethyl-5,6-dihydro-1,3-oxazine.
What is the SMILES notation for (6R)-2,4,4,6-tetramethyl-5,6-dihydro-1,3-oxazine?
The canonical SMILES for (6R)-2,4,4,6-tetramethyl-5,6-dihydro-1,3-oxazine is CC1=NC(C)(C)C[C@@H](C)O1.
What is the InChIKey of (6R)-2,4,4,6-tetramethyl-5,6-dihydro-1,3-oxazine?
The InChIKey is LZSGJOXDYPFFQB-ZCFIWIBFSA-N. The full InChI is InChI=1S/C8H15NO/c1-6-5-8(3,4)9-7(2)10-6/h6H,5H2,1-4H3/t6-/m1/s1.
What are the key properties of (6R)-2,4,4,6-tetramethyl-5,6-dihydro-1,3-oxazine?
(6R)-2,4,4,6-tetramethyl-5,6-dihydro-1,3-oxazine has a molecular weight of 141.21 g/mol, XLogP of 1.99, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (6R)-2,4,4,6-tetramethyl-5,6-dihydro-1,3-oxazine is sourced from PubChem (CID 7004113), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).