C8H17NO — CID 91500061
2,6-dimethyl-5,6-dihydro-4H-1,3-oxazine;ethane (PubChem CID 91500061) has the molecular formula C8H17NO and a molecular weight of 143.23 g/mol. Its IUPAC name is 2,6-dimethyl-5,6-dihydro-4H-1,3-oxazine;ethane.
| Compound Name | 2,6-dimethyl-5,6-dihydro-4H-1,3-oxazine;ethane |
|---|---|
| PubChem CID | 91500061 |
| Molecular Formula | C8H17NO |
| Molecular Weight | 143.23 g/mol |
| Exact Mass | 143.13 |
| IUPAC Name | 2,6-dimethyl-5,6-dihydro-4H-1,3-oxazine;ethane |
| SMILES | CC.CC1=NCCC(C)O1 |
| InChI | InChI=1S/C6H11NO.C2H6/c1-5-3-4-7-6(2)8-5;1-2/h5H,3-4H2,1-2H3;1-2H3 |
| InChIKey | USDWQHVERQFHAN-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.23 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |