C10H20INOS — CID 44657089
4,4,6-trimethyl-2-propan-2-ylsulfanyl-5,6-dihydro-1,3-oxazine;hydroiodide (PubChem CID 44657089) has the molecular formula C10H20INOS and a molecular weight of 329.25 g/mol. Its IUPAC name is 4,4,6-trimethyl-2-propan-2-ylsulfanyl-5,6-dihydro-1,3-oxazine;hydroiodide.
| Compound Name | 4,4,6-trimethyl-2-propan-2-ylsulfanyl-5,6-dihydro-1,3-oxazine;hydroiodide |
|---|---|
| PubChem CID | 44657089 |
| Molecular Formula | C10H20INOS |
| Molecular Weight | 329.25 g/mol |
| Exact Mass | 329.03 |
| IUPAC Name | 4,4,6-trimethyl-2-propan-2-ylsulfanyl-5,6-dihydro-1,3-oxazine;hydroiodide |
| SMILES | CC1CC(C)(C)N=C(SC(C)C)O1.I |
| InChI | InChI=1S/C10H19NOS.HI/c1-7(2)13-9-11-10(4,5)6-8(3)12-9;/h7-8H,6H2,1-5H3;1H |
| InChIKey | DREUCURTSPQHGK-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.25 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|