C26H28BrFNOP — CID 71600740
[fluoro-(4,4,6-trimethyl-5,6-dihydro-1,3-oxazin-2-yl)methyl]-triphenylphosphanium bromide (PubChem CID 71600740) has the molecular formula C26H28BrFNOP and a molecular weight of 500.39 g/mol. Its IUPAC name is [fluoro-(4,4,6-trimethyl-5,6-dihydro-1,3-oxazin-2-yl)methyl]-triphenylphosphanium bromide.
| Compound Name | [fluoro-(4,4,6-trimethyl-5,6-dihydro-1,3-oxazin-2-yl)methyl]-triphenylphosphanium bromide |
|---|---|
| PubChem CID | 71600740 |
| Molecular Formula | C26H28BrFNOP |
| Molecular Weight | 500.39 g/mol |
| Exact Mass | 499.11 |
| IUPAC Name | [fluoro-(4,4,6-trimethyl-5,6-dihydro-1,3-oxazin-2-yl)methyl]-triphenylphosphanium bromide |
| SMILES | CC1CC(C)(C)N=C(C(F)[P+](c2ccccc2)(c2ccccc2)c2ccccc2)O1.[Br-] |
| InChI | InChI=1S/C26H28FNOP.BrH/c1-20-19-26(2,3)28-25(29-20)24(27)30(21-13-7-4-8-14-21,22-15-9-5-10-16-22)23-17-11-6-12-18-23;/h4-18,20,24H,19H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | OQLPJJMGFIQXSC-UHFFFAOYSA-M |
| XLogP | 2.27 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.39 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|