C17H28O5 — CID 163023246
2-(3,4,8-trihydroxy-3,8-dimethyl-1,2,3a,4,5,6,7,8a-octahydroazulen-5-yl)prop-2-enyl acetate (PubChem CID 163023246) has the molecular formula C17H28O5 and a molecular weight of 312.41 g/mol. Its IUPAC name is 2-(3,4,8-trihydroxy-3,8-dimethyl-1,2,3a,4,5,6,7,8a-octahydroazulen-5-yl)prop-2-enyl acetate.
| Compound Name | 2-(3,4,8-trihydroxy-3,8-dimethyl-1,2,3a,4,5,6,7,8a-octahydroazulen-5-yl)prop-2-enyl acetate |
|---|---|
| PubChem CID | 163023246 |
| Molecular Formula | C17H28O5 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.19 |
| IUPAC Name | 2-(3,4,8-trihydroxy-3,8-dimethyl-1,2,3a,4,5,6,7,8a-octahydroazulen-5-yl)prop-2-enyl acetate |
| SMILES | C=C(COC(C)=O)C1CCC(C)(O)C2CCC(C)(O)C2C1O |
| InChI | InChI=1S/C17H28O5/c1-10(9-22-11(2)18)12-5-7-16(3,20)13-6-8-17(4,21)14(13)15(12)19/h12-15,19-21H,1,5-9H2,2-4H3 |
| InChIKey | MBBVSKBTNJDURZ-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|