C16H14N2O2S2 — CID 14823799
(4-methylphenyl)sulfonyl-(5-phenyl-1,2-thiazol-2-ium-2-yl)azanide (PubChem CID 14823799) has the molecular formula C16H14N2O2S2 and a molecular weight of 330.43 g/mol. Its IUPAC name is (4-methylphenyl)sulfonyl-(5-phenyl-1,2-thiazol-2-ium-2-yl)azanide.
| Compound Name | (4-methylphenyl)sulfonyl-(5-phenyl-1,2-thiazol-2-ium-2-yl)azanide |
|---|---|
| PubChem CID | 14823799 |
| Molecular Formula | C16H14N2O2S2 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.05 |
| IUPAC Name | (4-methylphenyl)sulfonyl-(5-phenyl-1,2-thiazol-2-ium-2-yl)azanide |
| SMILES | Cc1ccc(S(=O)(=O)[N-][n+]2ccc(-c3ccccc3)s2)cc1 |
| InChI | InChI=1S/C16H14N2O2S2/c1-13-7-9-15(10-8-13)22(19,20)17-18-12-11-16(21-18)14-5-3-2-4-6-14/h2-12H,1H3 |
| InChIKey | YFIPRXHHRDPMRC-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 52.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|