C8H13Br2NO — CID 14823927
2-bromo-2-(bromomethyl)-3-hydroxy-4,4-dimethylpentanenitrile (PubChem CID 14823927) has the molecular formula C8H13Br2NO and a molecular weight of 299.01 g/mol. Its IUPAC name is 2-bromo-2-(bromomethyl)-3-hydroxy-4,4-dimethylpentanenitrile.
| Compound Name | 2-bromo-2-(bromomethyl)-3-hydroxy-4,4-dimethylpentanenitrile |
|---|---|
| PubChem CID | 14823927 |
| Molecular Formula | C8H13Br2NO |
| Molecular Weight | 299.01 g/mol |
| Exact Mass | 296.94 |
| IUPAC Name | 2-bromo-2-(bromomethyl)-3-hydroxy-4,4-dimethylpentanenitrile |
| SMILES | CC(C)(C)C(O)C(Br)(C#N)CBr |
| InChI | InChI=1S/C8H13Br2NO/c1-7(2,3)6(12)8(10,4-9)5-11/h6,12H,4H2,1-3H3 |
| InChIKey | MSXKCHIVIYKRCT-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.01 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|