C8H7Cl3 — CID 14832347
1-chloro-2-(1,2-dichloroethyl)benzene (PubChem CID 14832347) has the molecular formula C8H7Cl3 and a molecular weight of 209.50 g/mol. Its IUPAC name is 1-chloro-2-(1,2-dichloroethyl)benzene.
| Compound Name | 1-chloro-2-(1,2-dichloroethyl)benzene |
|---|---|
| PubChem CID | 14832347 |
| Molecular Formula | C8H7Cl3 |
| Molecular Weight | 209.50 g/mol |
| Exact Mass | 207.96 |
| IUPAC Name | 1-chloro-2-(1,2-dichloroethyl)benzene |
| SMILES | ClCC(Cl)c1ccccc1Cl |
| InChI | InChI=1S/C8H7Cl3/c9-5-8(11)6-3-1-2-4-7(6)10/h1-4,8H,5H2 |
| InChIKey | OTXQUTFFXHHHHV-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.50 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|