C10H8Cl6 — CID 87433529
1-chloro-3-(1,2-dichloroethyl)-2-(1,2,2-trichloroethyl)benzene (PubChem CID 87433529) has the molecular formula C10H8Cl6 and a molecular weight of 340.89 g/mol. Its IUPAC name is 1-chloro-3-(1,2-dichloroethyl)-2-(1,2,2-trichloroethyl)benzene.
| Compound Name | 1-chloro-3-(1,2-dichloroethyl)-2-(1,2,2-trichloroethyl)benzene |
|---|---|
| PubChem CID | 87433529 |
| Molecular Formula | C10H8Cl6 |
| Molecular Weight | 340.89 g/mol |
| Exact Mass | 337.88 |
| IUPAC Name | 1-chloro-3-(1,2-dichloroethyl)-2-(1,2,2-trichloroethyl)benzene |
| SMILES | ClCC(Cl)c1cccc(Cl)c1C(Cl)C(Cl)Cl |
| InChI | InChI=1S/C10H8Cl6/c11-4-7(13)5-2-1-3-6(12)8(5)9(14)10(15)16/h1-3,7,9-10H,4H2 |
| InChIKey | QMJMWSADVDVZHD-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.89 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|